| 摘要 |
A camptothecin analog having the structure shown below: <IMAGE> <IMAGE> where Z is H or C1-8 alkyl and R is NO2, NH2, N3, hydrogen, halogen, COOH, OH, O-C1-3 alkyl, SH, S-C1-3 alkyl, CN, CH2NH2, NH-C1-3 alkyl, CH2-NH-C1-3 alkyl, N(C1-3 alkyl)2, CH2N(C1-3 alkyl)2, O-, NH-, or S-CH2CH2N(CH2CH2OH)2, O-, NH- or S- CH2CH2CH2N(CH2CH2OH)2, O-, NH- or S-CH2CH2N(CH2CH2CH2OH)2, O-, NH- or S-CH2CH2CH2N(CH2CH2CH2OH2)2, O-, NH- or S-CH2CH2N(C1-3 alkyl)2, O-, NH- or S-CH2CH2CH2N(C1-3 alkyl)2, CHO, C1-3 alkyl or NHCOCHR1NR2R3, where R1 is the side-chain of an alpha -amino acid and R2 and R3, independently are hydrogen or a lower alkyl group or R3 is a peptide unit containing 1-3 amino acid units bonded to the nitrogen through a peptide bond; NHCO-C2-8-alkylene-X or NHCO-C2-8-alkenylene-X, where X is COOH; CONR2-(CH2)n-NR2R3, where n=1-10 and R2 and R3 are as defined above; NHCO-B-(CH2)n-NR2R3, where B=oxygen or NH, or <IMAGE> where m+y=3-6, and salts thereof.
|
