主权项 |
1. A compound according to the formula: or a salt thereof, wherein: R2 is selected from phenyl mono-substituted at the 3- or 5-position with an R8 group and phenyl di- or tri-substituted with the same or different R8 groups; R4 is phenyl substituted with one or more of the same or different R8 groups; R2 and R4 are different; R5 is halogen; R6 is hydrogen; each R8 is selected from the group consisting of Ra, Rb, —O—(CH2)m—Rb, —S—(CH2)m—Rb, —O—CHRaRb, —O—CRa(Rb)2, —O—(CHRa)m—Rb, —C(O)NH—(CH2)m—Rb, —C(O)NH—(CHRa)m—Rb, —O—(CH2)m—C(O)NH—(CH2)m—Rb, —S—(CH2)m —C(O)NH—(CH2)m—Rb, —O—(CHRa)m—C(O)NH—(CHRa)m—Rb, —NH—(CH2)m—Rb, —NH—(CHRa)m —Rb, —NH[(CH2)mRb], —N[(CH2)mRb]2, —NH—C(O)—NH—(CH2)m—Rb, —NH—C(O)—(CH2)m—CHRbRb and —NH—(CH2)m—C(O)—NH—(CH2)m—Rb; each Ra is independently selected from the group consisting of (C1-C6) alkyl, (C3-C8) cycloalkyl, cyclohexyl, (C4-C11) cycloalkylalkyl, (C5-C10) aryl, phenyl, (C6-C16) arylalkyl, benzyl, 2-6 membered heteroalkyl, 3-8 membered cycloheteroalkyl, morpholinyl, piperazinyl, homopiperazinyl, piperidinyl, 4-11 membered cycloheteroalkylalkyl, 5-10 membered heteroaryl and 6-16 membered heteroarylalkyl; each Rb is a suitable group independently selected from the group consisting of ═O, —ORd, —OH, (C1-C3) haloalkyloxy, halogen, —CF3, —NC, —OCN, —SCN, —NO, —NO2, ═N2, —N3, —S(O)Rd, —S(O)2Rd, —S(O)2ORd, —S(O)NRcRc, —S(O)2NRcRc, —OS(O)Rd, —OS(O)2Rd, —OS(O)2ORd, —OS(O)2NRcRc, —C(O)Rd, —C(O)ORd, —C(O)NRcRc, —OC(O)Rd, —OC(O)ORd, —OC(O)NRcRc, —OC(NH)NRcRc, —OC(NRa)NRcRc, —[NHC(O)]nRd, —[NRaC(O)]nRd, —[NHC(O)]nORd, —[NRaC(O)]nORd, —[NHC(O)]nNRcRc, —[NRaC(O)]nNRcRc, —[NHC(NH)]nNRcRc and —[NRaC(NRa)]nNRcRc; each Rc is independently hydrogen or Ra, or, alternatively, each Rc is taken together with the nitrogen atom to which it is bonded to form a 5 to 8-membered cycloheteroalkyl or heteroaryl which may optionally include one or more of the same or different additional heteroatoms and which may optionally be substituted with one or more of the same or different Ra or suitable Rb groups; each Rd is independently hydrogen or Ra; each m is independently an integer from 1 to 3; and each n is independently an integer from 0 to 3, with the provisos that the compound is not
N2,N4-bis(3-methylphenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis(3-chlorophenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis(2,5-dimethylphenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis(3,4-dimethylphenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis(2,4-dimethylphenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis(3-bromophenyl)-5-fluoro-2,4-pyrimidinediamine;N2,N4-bis[(3-chloro-4-methoxyphenyl)]-5-fluoro-2,4-pyrimidinediamine;orN2,N4-Bis(3-chloro-4-methoxy)-5-fluoro-2,4-pyrimidinediamine. |