Silahydrocarbyl esters of 3-chloro-2-trifluoromethylpropionic acid, their preparation and preparation of the corresponding acrylic acid esters

摘要

An organic silicon compound represented by the following general formula: ClCH2CH(CF3)COOR3Si(R1)n(R2)3-n (wherein, R1 independently designates the same or different substituted or unsubstituted hydrocarbon groups having 1 to 20 carbon atoms, R2 independently designates the same or different groups selected from halogen groups or hydrolysable groups having 1 to 20 carbon atoms, R3 designates substituted or unsubstituted alkylene groups having 1 to 20 carbon atoms, and “n” is an integer from 0 to 3). The organic silicon compound is suitable for use as a preferable precursor in the manufacture of silanes that contain (2-trifluoromethylacryloxy)alkyl groups.