| 摘要 |
Propenyl ether compounds of the following general formula (1) CH3-CH=CH-(OR1 )n- OCO-X-COO-(R2O)n-CH=CH-CH, and allyl ether compounds of the following general formula (2) CH2 CH-CH2-(OR6)n-OCO-X - COO-(R7O)n-CH2-CH=CH2, both curable by free--radical polymerization, wherein X is -CH=CH- or -CH2-C(=CH2)-; R1, R2, R6 and R7 are each alkylene having 2 to 4 carbon atoms or cycloalkylene having 5 to 12 carbon atoms; and n is 1 to 5, with the proviso that when n is 1 in the formula (2), R6 and R7 are each alkylene having 3 to 4 carbon atoms or cycloalkylene having 5 to 12 carbon atoms. These compounds are obtained by the reaction of a corresponding dicarboxylic acid or a derivative thereof with an alcohol. The compounds of the general formula (1) are obtained by isomerizing allyl ether compounds.
|
