10, 11-Methylenedioxy-20 (RS) camptothecin and 10, 11-methylenedioxy-20 (S) - camptothecin analog.

摘要

A camptothecin analog having the structure shown below: <CHEM> where Z is H or C1-8 alkyl, R is NO2, NH2 N3, hydrogen, halogen, COOH, OH, O-C1-3 alkyl, SH, S-C1-3 alkyl, CN, CH2NH2, NH-C1-3 alkyl, CH2-NH-C1-3 alkyl, N(C1-3 alkyl)2, CH2N(C1-3 alkyl)2, O-, NH- or S-CH2CH2N(CH2CH2OH)2, O-, NH- or S-CH2CH2CH2N(CH2CH2OH)2, O-, NH- or S-CH2CH2N(CH2CH2CH2OH)2, O-, NH- or S-CH2CH2CH2N(CH2CH2CH2OH2)2, O-, NH- or S-CH2CH2N(C1-3 alkyl)2, O-, NH- or S-CH2CH2CH2N(C1-3 alkyl)2, CHO, C1-3 alkyl or NHCOCHR<1>NR<2>R<3>, where R<1> is the side-chain of an alpha -amino acid and R<2> and R<3>, independently, are hydrogen or a lower alkyl group or R<3> is a peptide unit containing 1-3 amino acid units bonded to the nitrogen through a peptide bond; NHCO-C2-8-alkylene-X or NHCO-C2-8-alkenylene-X, where X is COOH; CONR<2>-(CH2)n-NR<2>R<3>, where n = 1-10 and R<2> and R<3> are as defined above; NHCO-B-(CH2)n-NR<2>R<3>, where B = oxygen or NH; or <CHEM> where m + y = 3-6, and salts thereof. B