摘要 |
<p>The derivatives of dichloranhydrides of acylamidophosphoric acids have the following general formula: RCONHPO(X)Y, where R = CH2Cl, CHCl2, CCl3, CH3CHCl, CH2ClCCl2, para-ClC6H4; para-BrC6H4, 3-NO2-4-ClC6H3, 2,3,6-Cl3C6H2, X = Y = OCH3, OC2H5, SC6H4Cl-para, a compound formula (a), N(C2H5)2, NHCH2C6H5, NHC6H5, NHC6H4CH3-meta, -para, NHC6H3(CH3)2-2,5, NHC6H4OCH3-meta, NHC10H7-α, NHC10H7-β, NHC6H4Cl-orto, -meta, -para, NHC6H3Cl2-2,4, NHC6H3 NO2-orto-Cl-para, NHCH(CH2OH)CHOHC6H4NO2-para, and HNHC6H5. The claimed compounds have a biocidal activity and are the active substances of insecticidal, fungicidal and hematocidal preparations.</p> |