| 摘要 |
<p>The temperature indicators based on polydiacetylenic compounds are comprised of at least one polydiacetylenic compound presenting an irreversible thermochromism obtained by polymerization of a monomer having the formula (I): CH3-(CH2)n-C=C-C=C-(CH2)n'-CH3 wherein n and n' are similar or different integers comprised between 2 and 21, or a mixture of such monomers, the monomer or monomers being in a crystallized phase. Application: indication of a temperature change.</p> |
