摘要 |
Title compds. [I; A = 0-2; b = 0-2; n = 0-3; Rf', Rf = F, Cl, perfluoroalkyl, or fluorochloroalkyl; X' = Cl or Br (or a mixt. if n is over 1; Y = Cl, Br, I or F) were prepd. from the reaction of II and III. Thus, 50 ml tetraglyme and 8.35g CsF were heated 1 hr. at 45≰C, cooled to 0-10≰C, mixed with 7.26 g ClCF2COF, stirred 1 hr. at room temp., mixed with 10 g 2-(chlorldifluoromethyl) trifluorooxirane, and stirred 1 hr to give mainly 3 g ClCF2CF2OCF (CF2Cl)COF, 0.05 g ClCF2CF2OCF(CF2Cl)CF2OCF(CF2Cl)COF, and 0.05 g ClCF2CF2OCF(CF2Cl)CF2OCF(CF2Cl)CF2OCF(CF2Cl)COF.
|