3-Carboalkoxy (or phenoxy) and 3-thiocarbo-(3-chloro-2-propenyl)-1,3,5,7-tetraazabicyclo(3.3.1)nonane and preparation

摘要

Compounds of the formula <IMAGE> where X represents O or S and R represents C1-4 alkyl, phenyl or (C1-4 alkyl)phenyl. The compounds are prepared by reacting the ring-opened intermediate, obtained by reacting cis-1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo (3.3.1.13,7) decane chloride with excess aqueous sodium hydroxide, with an equivalent amount of a corresponding halide formate or halide thioformate, ClC=X(OR), at about 0 DEG C in the presenceof a hydrogen chloride acceptor and using a non-nucleophilic organic solvent as reaction medium. The carbamate products have antimicrobial utility.