| 摘要 |
<p>A process for the production of fluorine-containing fluorosulfonylalkyl vinyl ethers represented by the general formula: CF2=CFO(CF2CF(CF3)O)nCF2(CF2CF2)mCF2SO2F (wherein m is an integer of 0 to 5 and n is an integer of 0 to 10), characterized by reacting an ω-halogenated vinyl ether represented by the general formula: CF2=CFO(CF2CF(CF3)O)nCF2(CF2CF2)mCF2X (wherein X is I or Br, and m and n are each as defined above) with an alkali metal dithionite and a neutralizing agent to form a vinyl ether sulfinate represented by the general formula: CF2=CFO(CF2CF(CF3)O)nCF2(CF2CF2)mCF2SO2M (wherein M is Ma or Mb1/2; Ma is an alkali metal; Mb is an alkaline earth metal; and m and n are each as defined above), chlorinating the vinyl ether sulfinate, and then fluorinating the obtained compound. According to the process, fluorine-containing fluorosulfonyl- alkyl vinyl ethers can be industrially advantageously produced in high yield.</p> |
