| 摘要 |
PROBLEM TO BE SOLVED: To obtain an adhesive composition having a small refractive index difference between the adhesive composition and an optical material, having an excellent adhesive strength and capable of being easily coated and cured by making the composition contain a specific compound with a photopolymerization initiator. SOLUTION: This composition comprises (A) a compound of the formula: CH2=CHCOO-CH2(CF2)6-OCOCH=CH2 and (B) a photopolymerization initiator (for example, 2,2-dimethoxy-2-phenylacetophenone). The component A is produced, for example, by dissolving a compound of the formula: HOCH2(CF2)6CH2 OH and hydroxymonomethyl ether in chloroform, cooling the solution with methanol/dry ice, dropwisely adding triethylamine at a temp. of <=5 deg.C, cooling the reaction solution at -20 deg.C or lower, dropwisely adding the chloroform solution of acrylic acid chloride at -20 deg.C, returning the solution to room temperature, adding water, separating a layer, evaporating the layer and then separating residue with a silica gel column.
|
