| 摘要 |
The use of glycylglycine oleamide (I) in compositions to combat glycation (reaction between reducing sugars and collagen) and elastosis (breakdown of elastine by elastases) in connective tissue proteic fibers. (I) is a lipopeptide formed by the condensation of oleic acid with glycyl glycine , and has the formula CH3-(CH2)7-CH=CH-(CH2)7-CO-NH-CH2-CO-NH-CH2-COOH. It is a known compound US4732690; JP 5984994. Compositions preferably contain 0.0001 - 20% by weight of (I), these optionally also containing an anti-glycating agent such as amino guanidine, glycyl glycine, or phenacyl thiazolium bromide, anti-aging components such as retinal, vasculoprotectors such as rutine, iron chelating agents such as furildioxime, hormones, vitamins, anti-inflammatories, depigmenting agents, anti-hair loss agents, hydrating agents, solar filters, cicatrizing agents, mineral UV screens, etc.
|
