| 摘要 |
A compound of Formula (I) includes: [L]1-[N]n—OCH2CF2O(CF2CF2O)p(CF2O)qCF2CH2O—[M]m, where L is selected from the group consisting of (AA) M is selected from the group consisting of (BB) and N is (CC) where R1, R2, and R3 may be the same or different, and are selected from the group consisting of hydroxyl, phenyl, piperonyl, carboxylic acid, amide, 2,3-di-hydroxy-1-propoxyl, acetamide, methacrylate, methyl methacrylate and glycidyl ether; and where 1=0, 1, or 2, m=0, 1, or 2, n=1 or 2, and the ratio of p to q is from about 0.1 to 3.0. |
