| 摘要 |
<p>A coloring composition is provided to ensure excellent dispersibility, fluidity and preserving stability while showing high pigment concentration, by using zinc phthalocyanine pigment with excellent coloring property. A coloring composition comprises solvent(A), pigment(B) and basic dispersing agent(C). The solvent(A) comprises at least one kind of solvent selected from the group consisting of the solvent (A-1) represented by the chemical formula 1: CH3-C(=O)-O-(CnH2nO)m-C(=O)-CH3, and the solvent (A-2) represented by the chemical formula 2: -(O-C3H6)p-O-C(=O)-CH3. The pigment(B) comprises phthalocyanine pigment represented by the chemical formula 3. In the chemical formula 1, CnH2n is linear or branched alkylene chain; 1<=m<=3; and 2<=n<=5. In the chemical formula 2, R is C1-8 alkyl group; C3H6 is linear or branched propylene chain; and 1<=p<=3. In the chemical formula 3, M is Zn as a central metal element; and X1~X16 are an element selected from the group consisting of H, Cl, and Br.</p> |
