| 摘要 |
A method is provided for making a perfluorinated vinyl ether having a sulfonyl fluoride end-group according to the formula FSO2-(CF2)n-O-CF=CF2, where n is 2-5, comprising the steps of: a) fluorination of:to produce FSO2-(CF2)(n-1)-COF; b) reaction of FSO2-(CF2)(n-1)-COF with hexafluoropropylene oxide (HFPO) to produce FSO2-(CF2)(n)-O-CF(CF3)-COF; c) reaction of FSO2-(CF2)(n)-O-CF(CF3)-COF with a salt of a metal cation M+P, where p is the valence of M, to produce (FSO2-(CF2)(n)-O-CF(CF3)-COO<->)pM+P; and d) thermal cracking of FSO2-(CF2)(n)-O-CF(CF3)-COO<->)pM+P to produce FSO2-(CF2)(n)-O-CF=CF2.
|
